About porphyrin;prop-2-enal
porphyrin;prop-2-enal (PubChem CID 87785015) has the molecular formula C23H16N4O
and a molecular weight of 364.41 g/mol. Its IUPAC name is porphyrin;prop-2-enal.
Molecular Properties
| Compound Name | porphyrin;prop-2-enal |
| PubChem CID | 87785015 |
| Molecular Formula | C23H16N4O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | porphyrin;prop-2-enal |
| SMILES | C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.C=CC=O |
| InChI | InChI=1S/C20H12N4.C3H4O/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-2-3-4/h1-12H;2-3H,1H2/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | SINSDBJHFBTWOM-QDJBTJTOSA-N |
| XLogP | 3.95 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze porphyrin;prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of porphyrin;prop-2-enal?
The IUPAC name of porphyrin;prop-2-enal (CID 87785015) is porphyrin;prop-2-enal.
What is the SMILES notation for porphyrin;prop-2-enal?
The canonical SMILES for porphyrin;prop-2-enal is C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.C=CC=O.
What is the InChIKey of porphyrin;prop-2-enal?
The InChIKey is SINSDBJHFBTWOM-QDJBTJTOSA-N. The full InChI is InChI=1S/C20H12N4.C3H4O/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-2-3-4/h1-12H;2-3H,1H2/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;.
What are the key properties of porphyrin;prop-2-enal?
porphyrin;prop-2-enal has a molecular weight of 364.41 g/mol, XLogP of 3.95, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for porphyrin;prop-2-enal is sourced from PubChem (CID 87785015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).