About 6-pentyl-3,1-benzoxazine-2-thione
6-pentyl-3,1-benzoxazine-2-thione (PubChem CID 87785143) has the molecular formula C13H15NOS
and a molecular weight of 233.34 g/mol. Its IUPAC name is 6-pentyl-3,1-benzoxazine-2-thione.
Molecular Properties
| Compound Name | 6-pentyl-3,1-benzoxazine-2-thione |
| PubChem CID | 87785143 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 6-pentyl-3,1-benzoxazine-2-thione |
| SMILES | CCCCCc1ccc2nc(=S)occ2c1 |
| InChI | InChI=1S/C13H15NOS/c1-2-3-4-5-10-6-7-12-11(8-10)9-15-13(16)14-12/h6-9H,2-5H2,1H3 |
| InChIKey | TVDPGYWJWCRCPR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-pentyl-3,1-benzoxazine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pentyl-3,1-benzoxazine-2-thione?
The IUPAC name of 6-pentyl-3,1-benzoxazine-2-thione (CID 87785143) is 6-pentyl-3,1-benzoxazine-2-thione.
What is the SMILES notation for 6-pentyl-3,1-benzoxazine-2-thione?
The canonical SMILES for 6-pentyl-3,1-benzoxazine-2-thione is CCCCCc1ccc2nc(=S)occ2c1.
What is the InChIKey of 6-pentyl-3,1-benzoxazine-2-thione?
The InChIKey is TVDPGYWJWCRCPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NOS/c1-2-3-4-5-10-6-7-12-11(8-10)9-15-13(16)14-12/h6-9H,2-5H2,1H3.
What are the key properties of 6-pentyl-3,1-benzoxazine-2-thione?
6-pentyl-3,1-benzoxazine-2-thione has a molecular weight of 233.34 g/mol, XLogP of 4.29, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pentyl-3,1-benzoxazine-2-thione is sourced from PubChem (CID 87785143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).