C17H27FN2O2 — CID 87785635
2-(1-fluoropiperidin-4-yl)-1,4,7,7-tetramethyl-3-oxobicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 87785635) has the molecular formula C17H27FN2O2 and a molecular weight of 310.41 g/mol. Its IUPAC name is 2-(1-fluoropiperidin-4-yl)-1,4,7,7-tetramethyl-3-oxobicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 2-(1-fluoropiperidin-4-yl)-1,4,7,7-tetramethyl-3-oxobicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 87785635 |
| Molecular Formula | C17H27FN2O2 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-(1-fluoropiperidin-4-yl)-1,4,7,7-tetramethyl-3-oxobicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC12CCC(C)(C(C(N)=O)(C3CCN(F)CC3)C1=O)C2(C)C |
| InChI | InChI=1S/C17H27FN2O2/c1-14(2)15(3)7-8-16(14,4)17(12(15)21,13(19)22)11-5-9-20(18)10-6-11/h11H,5-10H2,1-4H3,(H2,19,22) |
| InChIKey | FKYDFOTZGLYOLM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|