C32H28Cl2F6N4O4 — CID 87785950
2-[(3,5-dichlorophenyl)methylidene]-N,N'-bis[2-morpholin-4-yl-3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 87785950) has the molecular formula C32H28Cl2F6N4O4 and a molecular weight of 717.49 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)methylidene]-N,N'-bis[2-morpholin-4-yl-3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | 2-[(3,5-dichlorophenyl)methylidene]-N,N'-bis[2-morpholin-4-yl-3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 87785950 |
| Molecular Formula | C32H28Cl2F6N4O4 |
| Molecular Weight | 717.49 g/mol |
| Exact Mass | 716.14 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)methylidene]-N,N'-bis[2-morpholin-4-yl-3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1N1CCOCC1)C(=Cc1cc(Cl)cc(Cl)c1)C(=O)Nc1cccc(C(F)(F)F)c1N1CCOCC1 |
| InChI | InChI=1S/C32H28Cl2F6N4O4/c33-20-15-19(16-21(34)18-20)17-22(29(45)41-25-5-1-3-23(31(35,36)37)27(25)43-7-11-47-12-8-43)30(46)42-26-6-2-4-24(32(38,39)40)28(26)44-9-13-48-14-10-44/h1-6,15-18H,7-14H2,(H,41,45)(H,42,46) |
| InChIKey | UREZRCIERQUKPI-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.49 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|