C20H21N3O2 — CID 8778606
3-benzyl-N,N-diethyl-4-oxophthalazine-1-carboxamide (PubChem CID 8778606) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 3-benzyl-N,N-diethyl-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N,N-diethyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 8778606 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3-benzyl-N,N-diethyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)c1nn(Cc2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H21N3O2/c1-3-22(4-2)20(25)18-16-12-8-9-13-17(16)19(24)23(21-18)14-15-10-6-5-7-11-15/h5-13H,3-4,14H2,1-2H3 |
| InChIKey | WBARMPDEFHPSDI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |