C24H30Cl6N2O6S2 — CID 87786077
2,4,6-trichloro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-3-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-(2,4,5-trichlorophenyl)sulfonylamino]benzenesulfonamide (PubChem CID 87786077) has the molecular formula C24H30Cl6N2O6S2 and a molecular weight of 719.36 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-3-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-(2,4,5-trichlorophenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | 2,4,6-trichloro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-3-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-(2,4,5-trichlorophenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 87786077 |
| Molecular Formula | C24H30Cl6N2O6S2 |
| Molecular Weight | 719.36 g/mol |
| Exact Mass | 715.97 |
| IUPAC Name | 2,4,6-trichloro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-3-[[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-(2,4,5-trichlorophenyl)sulfonylamino]benzenesulfonamide |
| SMILES | CC(C)(C)[C@@H](CO)NS(=O)(=O)c1c(Cl)cc(Cl)c(N([C@H](CO)C(C)(C)C)S(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)c1Cl |
| InChI | InChI=1S/C24H30Cl6N2O6S2/c1-23(2,3)18(10-33)31-39(35,36)22-16(29)8-15(28)21(20(22)30)32(19(11-34)24(4,5)6)40(37,38)17-9-13(26)12(25)7-14(17)27/h7-9,18-19,31,33-34H,10-11H2,1-6H3/t18-,19-/m1/s1 |
| InChIKey | ZCRMHTAEPFAIRI-RTBURBONSA-N |
| XLogP | 6.89 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.36 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|