C14H18N2O2 — CID 87786133
2,6-bis(2-isocyanatoethyl)-5,6-dimethylcyclohexa-1,3-diene (PubChem CID 87786133) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2,6-bis(2-isocyanatoethyl)-5,6-dimethylcyclohexa-1,3-diene.
| Compound Name | 2,6-bis(2-isocyanatoethyl)-5,6-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 87786133 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2,6-bis(2-isocyanatoethyl)-5,6-dimethylcyclohexa-1,3-diene |
| SMILES | CC1C=CC(CCN=C=O)=CC1(C)CCN=C=O |
| InChI | InChI=1S/C14H18N2O2/c1-12-3-4-13(5-7-15-10-17)9-14(12,2)6-8-16-11-18/h3-4,9,12H,5-8H2,1-2H3 |
| InChIKey | CLGLKIATCBJHCG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|