C7HF13 — CID 87786192
5-(difluoromethyl)-1,1,2,3,3,4,4,5,6,6,6-undecafluorohex-1-ene (PubChem CID 87786192) has the molecular formula C7HF13 and a molecular weight of 332.06 g/mol. Its IUPAC name is 5-(difluoromethyl)-1,1,2,3,3,4,4,5,6,6,6-undecafluorohex-1-ene.
| Compound Name | 5-(difluoromethyl)-1,1,2,3,3,4,4,5,6,6,6-undecafluorohex-1-ene |
|---|---|
| PubChem CID | 87786192 |
| Molecular Formula | C7HF13 |
| Molecular Weight | 332.06 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 5-(difluoromethyl)-1,1,2,3,3,4,4,5,6,6,6-undecafluorohex-1-ene |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(F)C(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C7HF13/c8-1(2(9)10)5(14,15)6(16,17)4(13,3(11)12)7(18,19)20/h3H |
| InChIKey | NNQASGLZKJDXTP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.06 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|