About sodium;ethanol;phosphoric acid
sodium;ethanol;phosphoric acid (PubChem CID 87786225) has the molecular formula C2H8NaO5P
and a molecular weight of 166.04 g/mol. Its IUPAC name is sodium;ethanol;phosphoric acid.
Molecular Properties
| Compound Name | sodium;ethanol;phosphoric acid |
| PubChem CID | 87786225 |
| Molecular Formula | C2H8NaO5P |
| Molecular Weight | 166.04 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | sodium;ethanol;phosphoric acid |
| SMILES | O=P(O)(O)O.[CH2-]CO.[Na+] |
| InChI | InChI=1S/C2H5O.Na.H3O4P/c1-2-3;;1-5(2,3)4/h3H,1-2H2;;(H3,1,2,3,4)/q-1;+1; |
| InChIKey | XYJXTBROOZFBAD-UHFFFAOYSA-N |
| XLogP | -4.11 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.04 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethanol;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethanol;phosphoric acid?
The IUPAC name of sodium;ethanol;phosphoric acid (CID 87786225) is sodium;ethanol;phosphoric acid.
What is the SMILES notation for sodium;ethanol;phosphoric acid?
The canonical SMILES for sodium;ethanol;phosphoric acid is O=P(O)(O)O.[CH2-]CO.[Na+].
What is the InChIKey of sodium;ethanol;phosphoric acid?
The InChIKey is XYJXTBROOZFBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5O.Na.H3O4P/c1-2-3;;1-5(2,3)4/h3H,1-2H2;;(H3,1,2,3,4)/q-1;+1;.
What are the key properties of sodium;ethanol;phosphoric acid?
sodium;ethanol;phosphoric acid has a molecular weight of 166.04 g/mol, XLogP of -4.11, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethanol;phosphoric acid is sourced from PubChem (CID 87786225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).