C20H37NO2 — CID 87786520
(9E,12E)-2-(1-hydroxyethyl)octadeca-9,12-dienamide (PubChem CID 87786520) has the molecular formula C20H37NO2 and a molecular weight of 323.52 g/mol. Its IUPAC name is (9E,12E)-2-(1-hydroxyethyl)octadeca-9,12-dienamide.
| Compound Name | (9E,12E)-2-(1-hydroxyethyl)octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 87786520 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | (9E,12E)-2-(1-hydroxyethyl)octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCC(C(N)=O)C(C)O |
| InChI | InChI=1S/C20H37NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(18(2)22)20(21)23/h7-8,10-11,18-19,22H,3-6,9,12-17H2,1-2H3,(H2,21,23)/b8-7+,11-10+ |
| InChIKey | HJLLVERDVBGKIN-ZDVGBALWSA-N |
| XLogP | 4.89 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|