C12H8F19N — CID 87786734
3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-N-methyl-9-(trifluoromethyl)decan-1-amine (PubChem CID 87786734) has the molecular formula C12H8F19N and a molecular weight of 527.17 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-N-methyl-9-(trifluoromethyl)decan-1-amine.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-N-methyl-9-(trifluoromethyl)decan-1-amine |
|---|---|
| PubChem CID | 87786734 |
| Molecular Formula | C12H8F19N |
| Molecular Weight | 527.17 g/mol |
| Exact Mass | 527.04 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-N-methyl-9-(trifluoromethyl)decan-1-amine |
| SMILES | CNCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F19N/c1-32-3-2-4(13,14)6(16,17)8(20,21)10(24,25)9(22,23)7(18,19)5(15,11(26,27)28)12(29,30)31/h32H,2-3H2,1H3 |
| InChIKey | AUJBFBZTHXOIIN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.17 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|