C12H7F20N — CID 87786735
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-icosafluoro-N,9-dimethyldecan-1-amine (PubChem CID 87786735) has the molecular formula C12H7F20N and a molecular weight of 545.16 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-icosafluoro-N,9-dimethyldecan-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-icosafluoro-N,9-dimethyldecan-1-amine |
|---|---|
| PubChem CID | 87786735 |
| Molecular Formula | C12H7F20N |
| Molecular Weight | 545.16 g/mol |
| Exact Mass | 545.03 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-icosafluoro-N,9-dimethyldecan-1-amine |
| SMILES | CNC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C12H7F20N/c1-3(13,11(28,29)30)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)12(31,32)33-2/h33H,1-2H3 |
| InChIKey | XYZRYIBEJQNWSM-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.16 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|