C20H14O — CID 87787264
1-methylidene-9-phenylxanthene (PubChem CID 87787264) has the molecular formula C20H14O and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-methylidene-9-phenylxanthene.
| Compound Name | 1-methylidene-9-phenylxanthene |
|---|---|
| PubChem CID | 87787264 |
| Molecular Formula | C20H14O |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-methylidene-9-phenylxanthene |
| SMILES | C=c1cccc2c1=C(c1ccccc1)c1ccccc1O2 |
| InChI | InChI=1S/C20H14O/c1-14-8-7-13-18-19(14)20(15-9-3-2-4-10-15)16-11-5-6-12-17(16)21-18/h2-13H,1H2 |
| InChIKey | WVHDLSWSWFPQAK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |