C27H31NO5S — CID 87787394
[(13S,17S)-8-ethenyl-3-hydroxy-13-methyl-4,6,7,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 4-sulfamoylbenzoate (PubChem CID 87787394) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is [(13S,17S)-8-ethenyl-3-hydroxy-13-methyl-4,6,7,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 4-sulfamoylbenzoate.
| Compound Name | [(13S,17S)-8-ethenyl-3-hydroxy-13-methyl-4,6,7,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 87787394 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [(13S,17S)-8-ethenyl-3-hydroxy-13-methyl-4,6,7,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 4-sulfamoylbenzoate |
| SMILES | C=CC12CCC3=C(C=C=C(O)C3)C1CC[C@@]1(C)C2CC[C@@H]1OC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C27H31NO5S/c1-3-27-15-12-18-16-19(29)6-9-21(18)22(27)13-14-26(2)23(27)10-11-24(26)33-25(30)17-4-7-20(8-5-17)34(28,31)32/h3-5,7-9,22-24,29H,1,10-16H2,2H3,(H2,28,31,32)/t22?,23?,24-,26-,27?/m0/s1 |
| InChIKey | JEPLOCJMDUFKBT-GGWLXUJESA-N |
| XLogP | 4.95 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|