C17H12F7NO3 — CID 87787453
1-(4-amino-3-methylphenyl)-2,2,2-trifluoro-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethanol (PubChem CID 87787453) has the molecular formula C17H12F7NO3 and a molecular weight of 411.27 g/mol. Its IUPAC name is 1-(4-amino-3-methylphenyl)-2,2,2-trifluoro-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethanol.
| Compound Name | 1-(4-amino-3-methylphenyl)-2,2,2-trifluoro-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethanol |
|---|---|
| PubChem CID | 87787453 |
| Molecular Formula | C17H12F7NO3 |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 1-(4-amino-3-methylphenyl)-2,2,2-trifluoro-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)ethanol |
| SMILES | Cc1cc(C(O)(c2ccc3c(c2)OC(F)(F)C(F)(F)O3)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C17H12F7NO3/c1-8-6-9(2-4-11(8)25)14(26,15(18,19)20)10-3-5-12-13(7-10)28-17(23,24)16(21,22)27-12/h2-7,26H,25H2,1H3 |
| InChIKey | BVHHUAHLIDOZHS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|