About 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine
5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine (PubChem CID 87787454) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine.
Molecular Properties
| Compound Name | 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine |
| PubChem CID | 87787454 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine |
| SMILES | NC1=NC=C2C=C[NH+]([O-])C=C21 |
| InChI | InChI=1S/C7H7N3O/c8-7-6-4-10(11)2-1-5(6)3-9-7/h1-4,10H,(H2,8,9) |
| InChIKey | WWKRDMRAZQGRFM-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine?
The IUPAC name of 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine (CID 87787454) is 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine.
What is the SMILES notation for 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine?
The canonical SMILES for 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine is NC1=NC=C2C=C[NH+]([O-])C=C21.
What is the InChIKey of 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine?
The InChIKey is WWKRDMRAZQGRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c8-7-6-4-10(11)2-1-5(6)3-9-7/h1-4,10H,(H2,8,9).
What are the key properties of 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine?
5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine has a molecular weight of 149.15 g/mol, XLogP of -0.96, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxido-5H-pyrrolo[3,4-c]pyridin-5-ium-3-amine is sourced from PubChem (CID 87787454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).