About 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol
3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol (PubChem CID 87787723) has the molecular formula C6H11N3OS
and a molecular weight of 173.24 g/mol. Its IUPAC name is 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol |
| PubChem CID | 87787723 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol |
| SMILES | Nc1cnc(NCCCO)s1 |
| InChI | InChI=1S/C6H11N3OS/c7-5-4-9-6(11-5)8-2-1-3-10/h4,10H,1-3,7H2,(H,8,9) |
| InChIKey | CEAQKWYCRGQPCZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol?
The IUPAC name of 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol (CID 87787723) is 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol.
What is the SMILES notation for 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol?
The canonical SMILES for 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol is Nc1cnc(NCCCO)s1.
What is the InChIKey of 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol?
The InChIKey is CEAQKWYCRGQPCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3OS/c7-5-4-9-6(11-5)8-2-1-3-10/h4,10H,1-3,7H2,(H,8,9).
What are the key properties of 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol?
3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol has a molecular weight of 173.24 g/mol, XLogP of 0.52, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-amino-1,3-thiazol-2-yl)amino]propan-1-ol is sourced from PubChem (CID 87787723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).