About 2,2-dichloroethenyl methyl pentan-3-yl phosphate
2,2-dichloroethenyl methyl pentan-3-yl phosphate (PubChem CID 87787733) has the molecular formula C8H15Cl2O4P
and a molecular weight of 277.08 g/mol. Its IUPAC name is 2,2-dichloroethenyl methyl pentan-3-yl phosphate.
Molecular Properties
| Compound Name | 2,2-dichloroethenyl methyl pentan-3-yl phosphate |
| PubChem CID | 87787733 |
| Molecular Formula | C8H15Cl2O4P |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 2,2-dichloroethenyl methyl pentan-3-yl phosphate |
| SMILES | CCC(CC)OP(=O)(OC)OC=C(Cl)Cl |
| InChI | InChI=1S/C8H15Cl2O4P/c1-4-7(5-2)14-15(11,12-3)13-6-8(9)10/h6-7H,4-5H2,1-3H3 |
| InChIKey | KOXTXYGAWLYUPX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloroethenyl methyl pentan-3-yl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloroethenyl methyl pentan-3-yl phosphate?
The IUPAC name of 2,2-dichloroethenyl methyl pentan-3-yl phosphate (CID 87787733) is 2,2-dichloroethenyl methyl pentan-3-yl phosphate.
What is the SMILES notation for 2,2-dichloroethenyl methyl pentan-3-yl phosphate?
The canonical SMILES for 2,2-dichloroethenyl methyl pentan-3-yl phosphate is CCC(CC)OP(=O)(OC)OC=C(Cl)Cl.
What is the InChIKey of 2,2-dichloroethenyl methyl pentan-3-yl phosphate?
The InChIKey is KOXTXYGAWLYUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15Cl2O4P/c1-4-7(5-2)14-15(11,12-3)13-6-8(9)10/h6-7H,4-5H2,1-3H3.
What are the key properties of 2,2-dichloroethenyl methyl pentan-3-yl phosphate?
2,2-dichloroethenyl methyl pentan-3-yl phosphate has a molecular weight of 277.08 g/mol, XLogP of 4.24, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloroethenyl methyl pentan-3-yl phosphate is sourced from PubChem (CID 87787733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).