carbonic acid;formic acid

C2H4O5 — CID 87787770

IUPACcarbonic acid;formic acid
SMILESO=C(O)O.O=CO
InChIInChI=1S/CH2O3.CH2O2/c2-1(3)4;2-1-3/h(H2,2,3,4);1H,(H,2,3)
InChIKeyFYPZKRVMRWWQBC-UHFFFAOYSA-N
MW108.05 g/mol
LogP-0.08
Rot. Bonds

About carbonic acid;formic acid

carbonic acid;formic acid (PubChem CID 87787770) has the molecular formula C2H4O5 and a molecular weight of 108.05 g/mol. Its IUPAC name is carbonic acid;formic acid.

Molecular Properties

Compound Namecarbonic acid;formic acid
PubChem CID87787770
Molecular FormulaC2H4O5
Molecular Weight108.05 g/mol
Exact Mass108.01
IUPAC Namecarbonic acid;formic acid
SMILESO=C(O)O.O=CO
InChIInChI=1S/CH2O3.CH2O2/c2-1(3)4;2-1-3/h(H2,2,3,4);1H,(H,2,3)
InChIKeyFYPZKRVMRWWQBC-UHFFFAOYSA-N
XLogP-0.08
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500108.05
LogP ≤ 5-0.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze carbonic acid;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonic acid;formic acid?
The IUPAC name of carbonic acid;formic acid (CID 87787770) is carbonic acid;formic acid.
What is the SMILES notation for carbonic acid;formic acid?
The canonical SMILES for carbonic acid;formic acid is O=C(O)O.O=CO.
What is the InChIKey of carbonic acid;formic acid?
The InChIKey is FYPZKRVMRWWQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.CH2O2/c2-1(3)4;2-1-3/h(H2,2,3,4);1H,(H,2,3).
What are the key properties of carbonic acid;formic acid?
carbonic acid;formic acid has a molecular weight of 108.05 g/mol, XLogP of -0.08, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;formic acid is sourced from PubChem (CID 87787770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).