About carbonic acid;formic acid
carbonic acid;formic acid (PubChem CID 87787770) has the molecular formula C2H4O5
and a molecular weight of 108.05 g/mol. Its IUPAC name is carbonic acid;formic acid.
Molecular Properties
| Compound Name | carbonic acid;formic acid |
| PubChem CID | 87787770 |
| Molecular Formula | C2H4O5 |
| Molecular Weight | 108.05 g/mol |
| Exact Mass | 108.01 |
| IUPAC Name | carbonic acid;formic acid |
| SMILES | O=C(O)O.O=CO |
| InChI | InChI=1S/CH2O3.CH2O2/c2-1(3)4;2-1-3/h(H2,2,3,4);1H,(H,2,3) |
| InChIKey | FYPZKRVMRWWQBC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.05 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;formic acid?
The IUPAC name of carbonic acid;formic acid (CID 87787770) is carbonic acid;formic acid.
What is the SMILES notation for carbonic acid;formic acid?
The canonical SMILES for carbonic acid;formic acid is O=C(O)O.O=CO.
What is the InChIKey of carbonic acid;formic acid?
The InChIKey is FYPZKRVMRWWQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.CH2O2/c2-1(3)4;2-1-3/h(H2,2,3,4);1H,(H,2,3).
What are the key properties of carbonic acid;formic acid?
carbonic acid;formic acid has a molecular weight of 108.05 g/mol, XLogP of -0.08, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;formic acid is sourced from PubChem (CID 87787770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).