About 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane
2-ethenyl-1-methylpyridin-1-ium;trifluoroborane (PubChem CID 87788827) has the molecular formula C8H10BF3N+
and a molecular weight of 187.98 g/mol. Its IUPAC name is 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane.
Molecular Properties
| Compound Name | 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane |
| PubChem CID | 87788827 |
| Molecular Formula | C8H10BF3N+ |
| Molecular Weight | 187.98 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane |
| SMILES | C=Cc1cccc[n+]1C.FB(F)F |
| InChI | InChI=1S/C8H10N.BF3/c1-3-8-6-4-5-7-9(8)2;2-1(3)4/h3-7H,1H2,2H3;/q+1; |
| InChIKey | ISHGJPMCRIIDIQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.98 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane?
The IUPAC name of 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane (CID 87788827) is 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane.
What is the SMILES notation for 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane?
The canonical SMILES for 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane is C=Cc1cccc[n+]1C.FB(F)F.
What is the InChIKey of 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane?
The InChIKey is ISHGJPMCRIIDIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N.BF3/c1-3-8-6-4-5-7-9(8)2;2-1(3)4/h3-7H,1H2,2H3;/q+1;.
What are the key properties of 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane?
2-ethenyl-1-methylpyridin-1-ium;trifluoroborane has a molecular weight of 187.98 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1-methylpyridin-1-ium;trifluoroborane is sourced from PubChem (CID 87788827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).