About N-methylsulfonyl-N'-propylmethanesulfonohydrazide
N-methylsulfonyl-N'-propylmethanesulfonohydrazide (PubChem CID 87789096) has the molecular formula C5H14N2O4S2
and a molecular weight of 230.31 g/mol. Its IUPAC name is N-methylsulfonyl-N'-propylmethanesulfonohydrazide.
Molecular Properties
| Compound Name | N-methylsulfonyl-N'-propylmethanesulfonohydrazide |
| PubChem CID | 87789096 |
| Molecular Formula | C5H14N2O4S2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | N-methylsulfonyl-N'-propylmethanesulfonohydrazide |
| SMILES | CCCNN(S(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C5H14N2O4S2/c1-4-5-6-7(12(2,8)9)13(3,10)11/h6H,4-5H2,1-3H3 |
| InChIKey | FMFLDSDEUSXSMV-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methylsulfonyl-N'-propylmethanesulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylsulfonyl-N'-propylmethanesulfonohydrazide?
The IUPAC name of N-methylsulfonyl-N'-propylmethanesulfonohydrazide (CID 87789096) is N-methylsulfonyl-N'-propylmethanesulfonohydrazide.
What is the SMILES notation for N-methylsulfonyl-N'-propylmethanesulfonohydrazide?
The canonical SMILES for N-methylsulfonyl-N'-propylmethanesulfonohydrazide is CCCNN(S(C)(=O)=O)S(C)(=O)=O.
What is the InChIKey of N-methylsulfonyl-N'-propylmethanesulfonohydrazide?
The InChIKey is FMFLDSDEUSXSMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2O4S2/c1-4-5-6-7(12(2,8)9)13(3,10)11/h6H,4-5H2,1-3H3.
What are the key properties of N-methylsulfonyl-N'-propylmethanesulfonohydrazide?
N-methylsulfonyl-N'-propylmethanesulfonohydrazide has a molecular weight of 230.31 g/mol, XLogP of -0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylsulfonyl-N'-propylmethanesulfonohydrazide is sourced from PubChem (CID 87789096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).