About (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate
(3-oxooxiran-2-yl) 2-methylidenepent-4-enoate (PubChem CID 87789492) has the molecular formula C8H8O4
and a molecular weight of 168.15 g/mol. Its IUPAC name is (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate.
Molecular Properties
| Compound Name | (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate |
| PubChem CID | 87789492 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate |
| SMILES | C=CCC(=C)C(=O)OC1OC1=O |
| InChI | InChI=1S/C8H8O4/c1-3-4-5(2)6(9)11-8-7(10)12-8/h3,8H,1-2,4H2 |
| InChIKey | PAXSCJKATNVSMJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate?
The IUPAC name of (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate (CID 87789492) is (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate.
What is the SMILES notation for (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate?
The canonical SMILES for (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate is C=CCC(=C)C(=O)OC1OC1=O.
What is the InChIKey of (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate?
The InChIKey is PAXSCJKATNVSMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4/c1-3-4-5(2)6(9)11-8-7(10)12-8/h3,8H,1-2,4H2.
What are the key properties of (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate?
(3-oxooxiran-2-yl) 2-methylidenepent-4-enoate has a molecular weight of 168.15 g/mol, XLogP of 0.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxooxiran-2-yl) 2-methylidenepent-4-enoate is sourced from PubChem (CID 87789492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).