About methacryl methoxysilane
methacryl methoxysilane (PubChem CID 87789932) has the molecular formula C5H8O2Si
and a molecular weight of 128.20 g/mol.
Molecular Properties
| Compound Name | methacryl methoxysilane |
|---|
| PubChem CID | 87789932 |
|---|
| Molecular Formula | C5H8O2Si |
|---|
| Molecular Weight | 128.20 g/mol |
|---|
| Exact Mass | 128.03 |
|---|
| IUPAC Name | — |
|---|
| SMILES | C=C(C)C(=O)[Si]OC |
|---|
| InChI | InChI=1S/C5H8O2Si/c1-4(2)5(6)8-7-3/h1H2,2-3H3 |
|---|
| InChIKey | HVIQAXAYXOIYAG-UHFFFAOYSA-N |
|---|
| XLogP | 0.35 |
|---|
| TPSA | 26.30 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 3 |
|---|
| Heavy Atoms | 8 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methacryl methoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methacryl methoxysilane?
The IUPAC name of methacryl methoxysilane (CID 87789932) is not available.
What is the SMILES notation for methacryl methoxysilane?
The canonical SMILES for methacryl methoxysilane is C=C(C)C(=O)[Si]OC.
What is the InChIKey of methacryl methoxysilane?
The InChIKey is HVIQAXAYXOIYAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2Si/c1-4(2)5(6)8-7-3/h1H2,2-3H3.
What are the key properties of methacryl methoxysilane?
methacryl methoxysilane has a molecular weight of 128.20 g/mol, XLogP of 0.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methacryl methoxysilane is sourced from PubChem (CID 87789932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).