About N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride
N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride (PubChem CID 87790767) has the molecular formula C19H24Cl2N4S
and a molecular weight of 411.40 g/mol. Its IUPAC name is N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride |
| PubChem CID | 87790767 |
| Molecular Formula | C19H24Cl2N4S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride |
| SMILES | CCCCCCc1ccc(Nc2nc(-c3ccccn3)cs2)nc1.Cl.Cl |
| InChI | InChI=1S/C19H22N4S.2ClH/c1-2-3-4-5-8-15-10-11-18(21-13-15)23-19-22-17(14-24-19)16-9-6-7-12-20-16;;/h6-7,9-14H,2-5,8H2,1H3,(H,21,22,23);2*1H |
| InChIKey | KJOOVOPMEJNUBR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride?
The IUPAC name of N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride (CID 87790767) is N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride.
What is the SMILES notation for N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride?
The canonical SMILES for N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride is CCCCCCc1ccc(Nc2nc(-c3ccccn3)cs2)nc1.Cl.Cl.
What is the InChIKey of N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride?
The InChIKey is KJOOVOPMEJNUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4S.2ClH/c1-2-3-4-5-8-15-10-11-18(21-13-15)23-19-22-17(14-24-19)16-9-6-7-12-20-16;;/h6-7,9-14H,2-5,8H2,1H3,(H,21,22,23);2*1H.
What are the key properties of N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride?
N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride has a molecular weight of 411.40 g/mol, XLogP of 6.31, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-hexyl-2-pyridinyl)-4-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride is sourced from PubChem (CID 87790767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).