About 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide
3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide (PubChem CID 87791633) has the molecular formula C15H25N3O5
and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide.
Molecular Properties
| Compound Name | 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide |
| PubChem CID | 87791633 |
| Molecular Formula | C15H25N3O5 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide |
| SMILES | C=C(CC(=O)NCC)C(=O)NC.C=C(CC(=O)O)C(=O)N(C)C |
| InChI | InChI=1S/C8H14N2O2.C7H11NO3/c1-4-10-7(11)5-6(2)8(12)9-3;1-5(4-6(9)10)7(11)8(2)3/h2,4-5H2,1,3H3,(H,9,12)(H,10,11);1,4H2,2-3H3,(H,9,10) |
| InChIKey | BQRSVRQJUQCIGW-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide?
The IUPAC name of 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide (CID 87791633) is 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide.
What is the SMILES notation for 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide?
The canonical SMILES for 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide is C=C(CC(=O)NCC)C(=O)NC.C=C(CC(=O)O)C(=O)N(C)C.
What is the InChIKey of 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide?
The InChIKey is BQRSVRQJUQCIGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2.C7H11NO3/c1-4-10-7(11)5-6(2)8(12)9-3;1-5(4-6(9)10)7(11)8(2)3/h2,4-5H2,1,3H3,(H,9,12)(H,10,11);1,4H2,2-3H3,(H,9,10).
What are the key properties of 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide?
3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide has a molecular weight of 327.38 g/mol, XLogP of -0.08, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylcarbamoyl)but-3-enoic acid;N'-ethyl-N-methyl-2-methylidenebutanediamide is sourced from PubChem (CID 87791633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).