About 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate
2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate (PubChem CID 87791870) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate.
Molecular Properties
| Compound Name | 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate |
| PubChem CID | 87791870 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate |
| SMILES | CCCC(CC1CO1)CC1CO1.O |
| InChI | InChI=1S/C10H18O2.H2O/c1-2-3-8(4-9-6-11-9)5-10-7-12-10;/h8-10H,2-7H2,1H3;1H2 |
| InChIKey | YNNGLGUNYMYLGB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 56.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate?
The IUPAC name of 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate (CID 87791870) is 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate.
What is the SMILES notation for 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate?
The canonical SMILES for 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate is CCCC(CC1CO1)CC1CO1.O.
What is the InChIKey of 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate?
The InChIKey is YNNGLGUNYMYLGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.H2O/c1-2-3-8(4-9-6-11-9)5-10-7-12-10;/h8-10H,2-7H2,1H3;1H2.
What are the key properties of 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate?
2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate has a molecular weight of 188.27 g/mol, XLogP of 1.16, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(oxiran-2-ylmethyl)pentyl]oxirane;hydrate is sourced from PubChem (CID 87791870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).