About N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+)
N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+) (PubChem CID 87791992) has the molecular formula C13H20N2O2RuS
and a molecular weight of 369.45 g/mol. Its IUPAC name is N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+).
Molecular Properties
| Compound Name | N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+) |
| PubChem CID | 87791992 |
| Molecular Formula | C13H20N2O2RuS |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+) |
| SMILES | CS(=O)(=O)N[C-]1CCCCC1N.[Ru+2].[c-]1ccccc1 |
| InChI | InChI=1S/C7H15N2O2S.C6H5.Ru/c1-12(10,11)9-7-5-3-2-4-6(7)8;1-2-4-6-5-3-1;/h6,9H,2-5,8H2,1H3;1-5H;/q2*-1;+2 |
| InChIKey | OMTWSSWSKFWDDG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+)?
The IUPAC name of N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+) (CID 87791992) is N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+).
What is the SMILES notation for N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+)?
The canonical SMILES for N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+) is CS(=O)(=O)N[C-]1CCCCC1N.[Ru+2].[c-]1ccccc1.
What is the InChIKey of N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+)?
The InChIKey is OMTWSSWSKFWDDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N2O2S.C6H5.Ru/c1-12(10,11)9-7-5-3-2-4-6(7)8;1-2-4-6-5-3-1;/h6,9H,2-5,8H2,1H3;1-5H;/q2*-1;+2.
What are the key properties of N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+)?
N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+) has a molecular weight of 369.45 g/mol, XLogP of 1.45, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminocyclohexyl)methanesulfonamide;benzene;ruthenium(2+) is sourced from PubChem (CID 87791992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).