About 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one
6-chloro-1H-pyridin-2-one;1H-pyridin-2-one (PubChem CID 87792012) has the molecular formula C10H9ClN2O2
and a molecular weight of 224.65 g/mol. Its IUPAC name is 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one.
Molecular Properties
| Compound Name | 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one |
| PubChem CID | 87792012 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one |
| SMILES | O=c1cccc(Cl)[nH]1.O=c1cccc[nH]1 |
| InChI | InChI=1S/C5H4ClNO.C5H5NO/c6-4-2-1-3-5(8)7-4;7-5-3-1-2-4-6-5/h1-3H,(H,7,8);1-4H,(H,6,7) |
| InChIKey | JBHMGIOLSOLPOL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one?
The IUPAC name of 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one (CID 87792012) is 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one.
What is the SMILES notation for 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one?
The canonical SMILES for 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one is O=c1cccc(Cl)[nH]1.O=c1cccc[nH]1.
What is the InChIKey of 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one?
The InChIKey is JBHMGIOLSOLPOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClNO.C5H5NO/c6-4-2-1-3-5(8)7-4;7-5-3-1-2-4-6-5/h1-3H,(H,7,8);1-4H,(H,6,7).
What are the key properties of 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one?
6-chloro-1H-pyridin-2-one;1H-pyridin-2-one has a molecular weight of 224.65 g/mol, XLogP of 1.40, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1H-pyridin-2-one;1H-pyridin-2-one is sourced from PubChem (CID 87792012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).