About (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide
(2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide (PubChem CID 87792222) has the molecular formula C10H11F3N2O5S
and a molecular weight of 328.27 g/mol. Its IUPAC name is (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
Molecular Properties
| Compound Name | (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| PubChem CID | 87792222 |
| Molecular Formula | C10H11F3N2O5S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide |
| SMILES | O=C(NO)[C@H](CO)NS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2O5S/c11-10(12,13)6-1-3-7(4-2-6)21(19,20)15-8(5-16)9(17)14-18/h1-4,8,15-16,18H,5H2,(H,14,17)/t8-/m0/s1 |
| InChIKey | QHBVWRDIBYCACT-QMMMGPOBSA-N |
| XLogP | -0.15 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide?
The IUPAC name of (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide (CID 87792222) is (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide.
What is the SMILES notation for (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide?
The canonical SMILES for (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide is O=C(NO)[C@H](CO)NS(=O)(=O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide?
The InChIKey is QHBVWRDIBYCACT-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H11F3N2O5S/c11-10(12,13)6-1-3-7(4-2-6)21(19,20)15-8(5-16)9(17)14-18/h1-4,8,15-16,18H,5H2,(H,14,17)/t8-/m0/s1.
What are the key properties of (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide?
(2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide has a molecular weight of 328.27 g/mol, XLogP of -0.15, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,3-dihydroxy-2-[[4-(trifluoromethyl)phenyl]sulfonylamino]propanamide is sourced from PubChem (CID 87792222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).