About (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide
(2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 87792773) has the molecular formula C13H13F3N2O5
and a molecular weight of 334.25 g/mol. Its IUPAC name is (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide |
| PubChem CID | 87792773 |
| Molecular Formula | C13H13F3N2O5 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(c1ccc(OC(F)(F)F)cc1)N(O)C(=O)[C@@H]1NCC[C@H]1O |
| InChI | InChI=1S/C13H13F3N2O5/c14-13(15,16)23-8-3-1-7(2-4-8)11(20)18(22)12(21)10-9(19)5-6-17-10/h1-4,9-10,17,19,22H,5-6H2/t9-,10-/m1/s1 |
| InChIKey | PYMLRBSMAQRVEM-NXEZZACHSA-N |
| XLogP | 0.67 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide?
The IUPAC name of (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide (CID 87792773) is (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide.
What is the SMILES notation for (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide?
The canonical SMILES for (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide is O=C(c1ccc(OC(F)(F)F)cc1)N(O)C(=O)[C@@H]1NCC[C@H]1O.
What is the InChIKey of (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide?
The InChIKey is PYMLRBSMAQRVEM-NXEZZACHSA-N. The full InChI is InChI=1S/C13H13F3N2O5/c14-13(15,16)23-8-3-1-7(2-4-8)11(20)18(22)12(21)10-9(19)5-6-17-10/h1-4,9-10,17,19,22H,5-6H2/t9-,10-/m1/s1.
What are the key properties of (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide?
(2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide has a molecular weight of 334.25 g/mol, XLogP of 0.67, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-N,3-dihydroxy-N-[4-(trifluoromethoxy)benzoyl]pyrrolidine-2-carboxamide is sourced from PubChem (CID 87792773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).