C38H40F3N3O5S — CID 87792896
5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethyl benzoate (PubChem CID 87792896) has the molecular formula C38H40F3N3O5S and a molecular weight of 707.82 g/mol. Its IUPAC name is 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethyl benzoate.
| Compound Name | 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethyl benzoate |
|---|---|
| PubChem CID | 87792896 |
| Molecular Formula | C38H40F3N3O5S |
| Molecular Weight | 707.82 g/mol |
| Exact Mass | 707.26 |
| IUPAC Name | 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethyl benzoate |
| SMILES | CC(Cc1cccc(C(F)(F)F)c1)NCCOC(=O)c1ccccc1.CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1 |
| InChI | InChI=1S/C19H20F3NO2.C19H20N2O3S/c1-14(12-15-6-5-9-17(13-15)19(20,21)22)23-10-11-25-18(24)16-7-3-2-4-8-16;1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17/h2-9,13-14,23H,10-12H2,1H3;3-8,12,17H,2,9-11H2,1H3,(H,21,22,23) |
| InChIKey | OWNSZSWDQUFBRC-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.82 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|