C28H54O2 — CID 87793675
2,6,10,13,17,21-hexamethyldocos-11-yne-10,13-diol (PubChem CID 87793675) has the molecular formula C28H54O2 and a molecular weight of 422.74 g/mol. Its IUPAC name is 2,6,10,13,17,21-hexamethyldocos-11-yne-10,13-diol.
| Compound Name | 2,6,10,13,17,21-hexamethyldocos-11-yne-10,13-diol |
|---|---|
| PubChem CID | 87793675 |
| Molecular Formula | C28H54O2 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.41 |
| IUPAC Name | 2,6,10,13,17,21-hexamethyldocos-11-yne-10,13-diol |
| SMILES | CC(C)CCCC(C)CCCC(C)(O)C#CC(C)(O)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C28H54O2/c1-23(2)13-9-15-25(5)17-11-19-27(7,29)21-22-28(8,30)20-12-18-26(6)16-10-14-24(3)4/h23-26,29-30H,9-20H2,1-8H3 |
| InChIKey | NQSLYRURGVWBBE-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|