About sodium;dimethylazanide;N-phenylaniline
sodium;dimethylazanide;N-phenylaniline (PubChem CID 87793775) has the molecular formula C14H17N2Na
and a molecular weight of 236.29 g/mol. Its IUPAC name is sodium;dimethylazanide;N-phenylaniline.
Molecular Properties
| Compound Name | sodium;dimethylazanide;N-phenylaniline |
| PubChem CID | 87793775 |
| Molecular Formula | C14H17N2Na |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | sodium;dimethylazanide;N-phenylaniline |
| SMILES | C[N-]C.[Na+].c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.C2H6N.Na/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2;/h1-10,13H;1-2H3;/q;-1;+1 |
| InChIKey | ULBYCTMDUAHEPG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 26.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;dimethylazanide;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dimethylazanide;N-phenylaniline?
The IUPAC name of sodium;dimethylazanide;N-phenylaniline (CID 87793775) is sodium;dimethylazanide;N-phenylaniline.
What is the SMILES notation for sodium;dimethylazanide;N-phenylaniline?
The canonical SMILES for sodium;dimethylazanide;N-phenylaniline is C[N-]C.[Na+].c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of sodium;dimethylazanide;N-phenylaniline?
The InChIKey is ULBYCTMDUAHEPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C2H6N.Na/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2;/h1-10,13H;1-2H3;/q;-1;+1.
What are the key properties of sodium;dimethylazanide;N-phenylaniline?
sodium;dimethylazanide;N-phenylaniline has a molecular weight of 236.29 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dimethylazanide;N-phenylaniline is sourced from PubChem (CID 87793775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).