About 2-propa-1,2-dienylcyclopentan-1-one
2-propa-1,2-dienylcyclopentan-1-one (PubChem CID 87793811) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 2-propa-1,2-dienylcyclopentan-1-one.
Molecular Properties
| Compound Name | 2-propa-1,2-dienylcyclopentan-1-one |
| PubChem CID | 87793811 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 2-propa-1,2-dienylcyclopentan-1-one |
| SMILES | C=C=CC1CCCC1=O |
| InChI | InChI=1S/C8H10O/c1-2-4-7-5-3-6-8(7)9/h4,7H,1,3,5-6H2 |
| InChIKey | DHWNOMUGQNQIFE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propa-1,2-dienylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propa-1,2-dienylcyclopentan-1-one?
The IUPAC name of 2-propa-1,2-dienylcyclopentan-1-one (CID 87793811) is 2-propa-1,2-dienylcyclopentan-1-one.
What is the SMILES notation for 2-propa-1,2-dienylcyclopentan-1-one?
The canonical SMILES for 2-propa-1,2-dienylcyclopentan-1-one is C=C=CC1CCCC1=O.
What is the InChIKey of 2-propa-1,2-dienylcyclopentan-1-one?
The InChIKey is DHWNOMUGQNQIFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-2-4-7-5-3-6-8(7)9/h4,7H,1,3,5-6H2.
What are the key properties of 2-propa-1,2-dienylcyclopentan-1-one?
2-propa-1,2-dienylcyclopentan-1-one has a molecular weight of 122.17 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propa-1,2-dienylcyclopentan-1-one is sourced from PubChem (CID 87793811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).