C40H76O7 — CID 87793851
2,6-dimethylheptan-2-yl 4-[1-(2,6-dimethylheptan-2-yloxy)-1-oxodecan-4-yl]oxycarbonyloxyundecanoate (PubChem CID 87793851) has the molecular formula C40H76O7 and a molecular weight of 669.04 g/mol. Its IUPAC name is 2,6-dimethylheptan-2-yl 4-[1-(2,6-dimethylheptan-2-yloxy)-1-oxodecan-4-yl]oxycarbonyloxyundecanoate.
| Compound Name | 2,6-dimethylheptan-2-yl 4-[1-(2,6-dimethylheptan-2-yloxy)-1-oxodecan-4-yl]oxycarbonyloxyundecanoate |
|---|---|
| PubChem CID | 87793851 |
| Molecular Formula | C40H76O7 |
| Molecular Weight | 669.04 g/mol |
| Exact Mass | 668.56 |
| IUPAC Name | 2,6-dimethylheptan-2-yl 4-[1-(2,6-dimethylheptan-2-yloxy)-1-oxodecan-4-yl]oxycarbonyloxyundecanoate |
| SMILES | CCCCCCCC(CCC(=O)OC(C)(C)CCCC(C)C)OC(=O)OC(CCCCCC)CCC(=O)OC(C)(C)CCCC(C)C |
| InChI | InChI=1S/C40H76O7/c1-11-13-15-17-19-25-35(27-29-37(42)47-40(9,10)31-21-23-33(5)6)45-38(43)44-34(24-18-16-14-12-2)26-28-36(41)46-39(7,8)30-20-22-32(3)4/h32-35H,11-31H2,1-10H3 |
| InChIKey | JJADZVVRVJVFEQ-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.04 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|