About 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine
4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine (PubChem CID 87793963) has the molecular formula C11H15NO2S
and a molecular weight of 225.31 g/mol. Its IUPAC name is 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine |
| PubChem CID | 87793963 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine |
| SMILES | O=S(=O)=C1CC=CC=C1C1CCNCC1 |
| InChI | InChI=1S/C11H15NO2S/c13-15(14)11-4-2-1-3-10(11)9-5-7-12-8-6-9/h1-3,9,12H,4-8H2 |
| InChIKey | NTGDYWSAORSWJL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine?
The IUPAC name of 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine (CID 87793963) is 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine.
What is the SMILES notation for 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine?
The canonical SMILES for 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine is O=S(=O)=C1CC=CC=C1C1CCNCC1.
What is the InChIKey of 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine?
The InChIKey is NTGDYWSAORSWJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c13-15(14)11-4-2-1-3-10(11)9-5-7-12-8-6-9/h1-3,9,12H,4-8H2.
What are the key properties of 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine?
4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine has a molecular weight of 225.31 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-sulfonylcyclohexa-1,3-dien-1-yl)piperidine is sourced from PubChem (CID 87793963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).