About 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide
2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide (PubChem CID 87794018) has the molecular formula C27H26N2O5S
and a molecular weight of 490.58 g/mol. Its IUPAC name is 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide |
| PubChem CID | 87794018 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccccc1-c1cc(S(N)(=O)=O)c(N)c(-c2ccccc2OC)c1-c1ccccc1OC |
| InChI | InChI=1S/C27H26N2O5S/c1-32-21-13-7-4-10-17(21)20-16-24(35(29,30)31)27(28)26(19-12-6-9-15-23(19)34-3)25(20)18-11-5-8-14-22(18)33-2/h4-16H,28H2,1-3H3,(H2,29,30,31) |
| InChIKey | XNTLORNJLMYZJC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide?
The IUPAC name of 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide (CID 87794018) is 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide.
What is the SMILES notation for 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide?
The canonical SMILES for 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide is COc1ccccc1-c1cc(S(N)(=O)=O)c(N)c(-c2ccccc2OC)c1-c1ccccc1OC.
What is the InChIKey of 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide?
The InChIKey is XNTLORNJLMYZJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O5S/c1-32-21-13-7-4-10-17(21)20-16-24(35(29,30)31)27(28)26(19-12-6-9-15-23(19)34-3)25(20)18-11-5-8-14-22(18)33-2/h4-16H,28H2,1-3H3,(H2,29,30,31).
What are the key properties of 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide?
2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide has a molecular weight of 490.58 g/mol, XLogP of 4.94, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,4,5-tris(2-methoxyphenyl)benzenesulfonamide is sourced from PubChem (CID 87794018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).