About (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione
(2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione (PubChem CID 87794112) has the molecular formula C9H3Cl2NO3
and a molecular weight of 244.03 g/mol. Its IUPAC name is (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione.
Molecular Properties
| Compound Name | (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione |
| PubChem CID | 87794112 |
| Molecular Formula | C9H3Cl2NO3 |
| Molecular Weight | 244.03 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione |
| SMILES | O=c1/c(=N/O)c(=O)c2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C9H3Cl2NO3/c10-3-1-4-6(5(11)2-3)9(14)7(12-15)8(4)13/h1-2,15H/b12-7- |
| InChIKey | XGGRURJGFYBNKZ-GHXNOFRVSA-N |
| XLogP | 1.03 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.03 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione?
The IUPAC name of (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione (CID 87794112) is (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione.
What is the SMILES notation for (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione?
The canonical SMILES for (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione is O=c1/c(=N/O)c(=O)c2c(Cl)cc(Cl)cc12.
What is the InChIKey of (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione?
The InChIKey is XGGRURJGFYBNKZ-GHXNOFRVSA-N. The full InChI is InChI=1S/C9H3Cl2NO3/c10-3-1-4-6(5(11)2-3)9(14)7(12-15)8(4)13/h1-2,15H/b12-7-.
What are the key properties of (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione?
(2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione has a molecular weight of 244.03 g/mol, XLogP of 1.03, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-4,6-dichloro-2-hydroxyiminoindene-1,3-dione is sourced from PubChem (CID 87794112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).