About 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine
5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine (PubChem CID 87794120) has the molecular formula C15H8Br2F3IN4
and a molecular weight of 587.96 g/mol. Its IUPAC name is 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine.
Molecular Properties
| Compound Name | 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine |
| PubChem CID | 87794120 |
| Molecular Formula | C15H8Br2F3IN4 |
| Molecular Weight | 587.96 g/mol |
| Exact Mass | 585.81 |
| IUPAC Name | 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine |
| SMILES | Brc1cnc(I)nc1.FC(F)(F)c1ccc(-c2ncc(Br)cn2)cc1 |
| InChI | InChI=1S/C11H6BrF3N2.C4H2BrIN2/c12-9-5-16-10(17-6-9)7-1-3-8(4-2-7)11(13,14)15;5-3-1-7-4(6)8-2-3/h1-6H;1-2H |
| InChIKey | ANPNCCIKIAQFOX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.96 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine?
The IUPAC name of 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine (CID 87794120) is 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine.
What is the SMILES notation for 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine?
The canonical SMILES for 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine is Brc1cnc(I)nc1.FC(F)(F)c1ccc(-c2ncc(Br)cn2)cc1.
What is the InChIKey of 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine?
The InChIKey is ANPNCCIKIAQFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6BrF3N2.C4H2BrIN2/c12-9-5-16-10(17-6-9)7-1-3-8(4-2-7)11(13,14)15;5-3-1-7-4(6)8-2-3/h1-6H;1-2H.
What are the key properties of 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine?
5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine has a molecular weight of 587.96 g/mol, XLogP of 5.77, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-iodopyrimidine;5-bromo-2-[4-(trifluoromethyl)phenyl]pyrimidine is sourced from PubChem (CID 87794120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).