C26H38F6O3 — CID 87794263
(1S,3R)-6-methylidene-7-[(E)-2-[(1S,3R)-2,2,3-trimethyl-3-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)heptan-2-yl]cyclopentyl]ethenyl]bicyclo[3.1.1]heptane-1,3-diol (PubChem CID 87794263) has the molecular formula C26H38F6O3 and a molecular weight of 512.58 g/mol. Its IUPAC name is (1S,3R)-6-methylidene-7-[(E)-2-[(1S,3R)-2,2,3-trimethyl-3-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)heptan-2-yl]cyclopentyl]ethenyl]bicyclo[3.1.1]heptane-1,3-diol.
| Compound Name | (1S,3R)-6-methylidene-7-[(E)-2-[(1S,3R)-2,2,3-trimethyl-3-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)heptan-2-yl]cyclopentyl]ethenyl]bicyclo[3.1.1]heptane-1,3-diol |
|---|---|
| PubChem CID | 87794263 |
| Molecular Formula | C26H38F6O3 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | (1S,3R)-6-methylidene-7-[(E)-2-[(1S,3R)-2,2,3-trimethyl-3-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)heptan-2-yl]cyclopentyl]ethenyl]bicyclo[3.1.1]heptane-1,3-diol |
| SMILES | C=C1C2C[C@@H](O)C[C@]1(O)C2/C=C/[C@@H]1CC[C@](C)([C@H](C)CCCC(O)(C(F)(F)F)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C26H38F6O3/c1-15(7-6-11-24(35,25(27,28)29)26(30,31)32)22(5)12-10-17(21(22,3)4)8-9-20-19-13-18(33)14-23(20,34)16(19)2/h8-9,15,17-20,33-35H,2,6-7,10-14H2,1,3-5H3/b9-8+/t15-,17-,18-,19?,20?,22-,23-/m1/s1 |
| InChIKey | KGYNGWLATGGWIS-YULUVXFVSA-N |
| XLogP | 6.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|