About ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid
ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid (PubChem CID 87794544) has the molecular formula C13H18O5
and a molecular weight of 254.28 g/mol. Its IUPAC name is ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid.
Molecular Properties
| Compound Name | ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid |
| PubChem CID | 87794544 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid |
| SMILES | C=COC(C)=O.O=C(O)C1=CCCC1CC1CO1 |
| InChI | InChI=1S/C9H12O3.C4H6O2/c10-9(11)8-3-1-2-6(8)4-7-5-12-7;1-3-6-4(2)5/h3,6-7H,1-2,4-5H2,(H,10,11);3H,1H2,2H3 |
| InChIKey | HFLMSOYIOGILCU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid?
The IUPAC name of ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid (CID 87794544) is ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid.
What is the SMILES notation for ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid?
The canonical SMILES for ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid is C=COC(C)=O.O=C(O)C1=CCCC1CC1CO1.
What is the InChIKey of ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid?
The InChIKey is HFLMSOYIOGILCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3.C4H6O2/c10-9(11)8-3-1-2-6(8)4-7-5-12-7;1-3-6-4(2)5/h3,6-7H,1-2,4-5H2,(H,10,11);3H,1H2,2H3.
What are the key properties of ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid?
ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid has a molecular weight of 254.28 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl acetate;5-(oxiran-2-ylmethyl)cyclopentene-1-carboxylic acid is sourced from PubChem (CID 87794544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).