C37H34O8 — CID 87794830
(2E,4E)-3,4,6-trimethoxy-5-[2-(3-methoxyphenoxy)phenyl]-2-[5-methyl-2-(2-phenylethenyl)phenyl]-6-oxohexa-2,4-dienoic acid (PubChem CID 87794830) has the molecular formula C37H34O8 and a molecular weight of 606.67 g/mol. Its IUPAC name is (2E,4E)-3,4,6-trimethoxy-5-[2-(3-methoxyphenoxy)phenyl]-2-[5-methyl-2-(2-phenylethenyl)phenyl]-6-oxohexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-3,4,6-trimethoxy-5-[2-(3-methoxyphenoxy)phenyl]-2-[5-methyl-2-(2-phenylethenyl)phenyl]-6-oxohexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 87794830 |
| Molecular Formula | C37H34O8 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | (2E,4E)-3,4,6-trimethoxy-5-[2-(3-methoxyphenoxy)phenyl]-2-[5-methyl-2-(2-phenylethenyl)phenyl]-6-oxohexa-2,4-dienoic acid |
| SMILES | COC(=O)/C(=C(OC)\C(OC)=C(/C(=O)O)c1cc(C)ccc1C=Cc1ccccc1)c1ccccc1Oc1cccc(OC)c1 |
| InChI | InChI=1S/C37H34O8/c1-24-18-20-26(21-19-25-12-7-6-8-13-25)30(22-24)32(36(38)39)34(42-3)35(43-4)33(37(40)44-5)29-16-9-10-17-31(29)45-28-15-11-14-27(23-28)41-2/h6-23H,1-5H3,(H,38,39)/b21-19?,34-32+,35-33+ |
| InChIKey | YDXJQEDEDAUYPD-OZBWSIFTSA-N |
| XLogP | 7.64 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|