About (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone
(1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone (PubChem CID 87795115) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone.
Molecular Properties
| Compound Name | (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone |
| PubChem CID | 87795115 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone |
| SMILES | COC1(C(=O)[C@H]2O[C@@H]2C(C)C)C=CC=CC1 |
| InChI | InChI=1S/C13H18O3/c1-9(2)10-11(16-10)12(14)13(15-3)7-5-4-6-8-13/h4-7,9-11H,8H2,1-3H3/t10-,11+,13?/m1/s1 |
| InChIKey | FHXBDILZBDZLCY-ILWADHIDSA-N |
| XLogP | 1.88 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone?
The IUPAC name of (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone (CID 87795115) is (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone.
What is the SMILES notation for (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone?
The canonical SMILES for (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone is COC1(C(=O)[C@H]2O[C@@H]2C(C)C)C=CC=CC1.
What is the InChIKey of (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone?
The InChIKey is FHXBDILZBDZLCY-ILWADHIDSA-N. The full InChI is InChI=1S/C13H18O3/c1-9(2)10-11(16-10)12(14)13(15-3)7-5-4-6-8-13/h4-7,9-11H,8H2,1-3H3/t10-,11+,13?/m1/s1.
What are the key properties of (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone?
(1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone has a molecular weight of 222.28 g/mol, XLogP of 1.88, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methoxycyclohexa-2,4-dien-1-yl)-[(2S,3R)-3-propan-2-yloxiran-2-yl]methanone is sourced from PubChem (CID 87795115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).