About [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide
[(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide (PubChem CID 87795389) has the molecular formula C24H22BrF3NOP
and a molecular weight of 508.32 g/mol. Its IUPAC name is [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide.
Molecular Properties
| Compound Name | [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide |
| PubChem CID | 87795389 |
| Molecular Formula | C24H22BrF3NOP |
| Molecular Weight | 508.32 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide |
| SMILES | O=C1[C@H]([P+](c2ccccc2)(c2ccccc2)c2ccccc2)CCN1CC(F)(F)F.[Br-] |
| InChI | InChI=1S/C24H22F3NOP.BrH/c25-24(26,27)18-28-17-16-22(23(28)29)30(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21;/h1-15,22H,16-18H2;1H/q+1;/p-1/t22-;/m1./s1 |
| InChIKey | WXJFKAOOMXIHNH-VZYDHVRKSA-M |
| XLogP | 1.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide?
The IUPAC name of [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide (CID 87795389) is [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide.
What is the SMILES notation for [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide?
The canonical SMILES for [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide is O=C1[C@H]([P+](c2ccccc2)(c2ccccc2)c2ccccc2)CCN1CC(F)(F)F.[Br-].
What is the InChIKey of [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide?
The InChIKey is WXJFKAOOMXIHNH-VZYDHVRKSA-M. The full InChI is InChI=1S/C24H22F3NOP.BrH/c25-24(26,27)18-28-17-16-22(23(28)29)30(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21;/h1-15,22H,16-18H2;1H/q+1;/p-1/t22-;/m1./s1.
What are the key properties of [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide?
[(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide has a molecular weight of 508.32 g/mol, XLogP of 1.15, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-triphenylphosphanium bromide is sourced from PubChem (CID 87795389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).