About N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline
N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline (PubChem CID 87795616) has the molecular formula C21H26N4S
and a molecular weight of 366.53 g/mol. Its IUPAC name is N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline.
Molecular Properties
| Compound Name | N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline |
| PubChem CID | 87795616 |
| Molecular Formula | C21H26N4S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline |
| SMILES | CCN(Cc1ccccc1)c1ccc(/N=N/C2SC(C)=CN2C)c(C)c1 |
| InChI | InChI=1S/C21H26N4S/c1-5-25(15-18-9-7-6-8-10-18)19-11-12-20(16(2)13-19)22-23-21-24(4)14-17(3)26-21/h6-14,21H,5,15H2,1-4H3/b23-22+ |
| InChIKey | QINYSSPGTITAFM-GHVJWSGMSA-N |
| XLogP | 5.93 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline?
The IUPAC name of N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline (CID 87795616) is N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline.
What is the SMILES notation for N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline?
The canonical SMILES for N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline is CCN(Cc1ccccc1)c1ccc(/N=N/C2SC(C)=CN2C)c(C)c1.
What is the InChIKey of N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline?
The InChIKey is QINYSSPGTITAFM-GHVJWSGMSA-N. The full InChI is InChI=1S/C21H26N4S/c1-5-25(15-18-9-7-6-8-10-18)19-11-12-20(16(2)13-19)22-23-21-24(4)14-17(3)26-21/h6-14,21H,5,15H2,1-4H3/b23-22+.
What are the key properties of N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline?
N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline has a molecular weight of 366.53 g/mol, XLogP of 5.93, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-[(3,5-dimethyl-2H-1,3-thiazol-2-yl)diazenyl]-N-ethyl-3-methylaniline is sourced from PubChem (CID 87795616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).