About 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde
2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde (PubChem CID 87795646) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde |
| PubChem CID | 87795646 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde |
| SMILES | CCc1c(O)ccc(CC=O)c1O |
| InChI | InChI=1S/C10H12O3/c1-2-8-9(12)4-3-7(5-6-11)10(8)13/h3-4,6,12-13H,2,5H2,1H3 |
| InChIKey | ZYKPWTJLXQNMHZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde?
The IUPAC name of 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde (CID 87795646) is 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde.
What is the SMILES notation for 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde?
The canonical SMILES for 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde is CCc1c(O)ccc(CC=O)c1O.
What is the InChIKey of 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde?
The InChIKey is ZYKPWTJLXQNMHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-2-8-9(12)4-3-7(5-6-11)10(8)13/h3-4,6,12-13H,2,5H2,1H3.
What are the key properties of 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde?
2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde has a molecular weight of 180.20 g/mol, XLogP of 1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-2,4-dihydroxyphenyl)acetaldehyde is sourced from PubChem (CID 87795646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).