C13H14F3NO2 — CID 87795705
(2R)-2-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoic acid (PubChem CID 87795705) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is (2R)-2-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoic acid.
| Compound Name | (2R)-2-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoic acid |
|---|---|
| PubChem CID | 87795705 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2R)-2-methyl-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]butanoic acid |
| SMILES | CC[C@@](C)(/N=C(\c1ccccc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H14F3NO2/c1-3-12(2,11(18)19)17-10(13(14,15)16)9-7-5-4-6-8-9/h4-8H,3H2,1-2H3,(H,18,19)/b17-10+/t12-/m1/s1 |
| InChIKey | JOPKZRICUKXPJX-YXHQGMJNSA-N |
| XLogP | 3.29 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|