About CID 87795890
CID 87795890 (PubChem CID 87795890) has the molecular formula C25H22AsN6O2S
and a molecular weight of 545.48 g/mol.
Molecular Properties
| Compound Name | CID 87795890 |
| PubChem CID | 87795890 |
| Molecular Formula | C25H22AsN6O2S |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2nc3ccccn3c2-c2ccnc([As]CCc3ccc(S(N)(=O)=O)cc3)n2)n1 |
| InChI | InChI=1S/C25H22AsN6O2S/c1-17-5-4-6-20(29-17)23-24(32-16-3-2-7-22(32)31-23)21-13-15-28-25(30-21)26-14-12-18-8-10-19(11-9-18)35(27,33)34/h2-11,13,15-16H,12,14H2,1H3,(H2,27,33,34) |
| InChIKey | XPQUPJGSNRZZHM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87795890 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87795890?
The IUPAC name of CID 87795890 (CID 87795890) is not available.
What is the SMILES notation for CID 87795890?
The canonical SMILES for CID 87795890 is Cc1cccc(-c2nc3ccccn3c2-c2ccnc([As]CCc3ccc(S(N)(=O)=O)cc3)n2)n1.
What is the InChIKey of CID 87795890?
The InChIKey is XPQUPJGSNRZZHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22AsN6O2S/c1-17-5-4-6-20(29-17)23-24(32-16-3-2-7-22(32)31-23)21-13-15-28-25(30-21)26-14-12-18-8-10-19(11-9-18)35(27,33)34/h2-11,13,15-16H,12,14H2,1H3,(H2,27,33,34).
What are the key properties of CID 87795890?
CID 87795890 has a molecular weight of 545.48 g/mol, XLogP of 2.80, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87795890 is sourced from PubChem (CID 87795890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).