C26H25N5O — CID 87796310
2-[[3-[(E)-2-(2,4-dimethyl-1H-pyridin-2-yl)ethenyl]-1H-indazol-6-yl]amino]-N-prop-2-ynylbenzamide (PubChem CID 87796310) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-[[3-[(E)-2-(2,4-dimethyl-1H-pyridin-2-yl)ethenyl]-1H-indazol-6-yl]amino]-N-prop-2-ynylbenzamide.
| Compound Name | 2-[[3-[(E)-2-(2,4-dimethyl-1H-pyridin-2-yl)ethenyl]-1H-indazol-6-yl]amino]-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 87796310 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 2-[[3-[(E)-2-(2,4-dimethyl-1H-pyridin-2-yl)ethenyl]-1H-indazol-6-yl]amino]-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1ccccc1Nc1ccc2c(/C=C/C3(C)C=C(C)C=CN3)n[nH]c2c1 |
| InChI | InChI=1S/C26H25N5O/c1-4-14-27-25(32)21-7-5-6-8-22(21)29-19-9-10-20-23(30-31-24(20)16-19)11-13-26(3)17-18(2)12-15-28-26/h1,5-13,15-17,28-29H,14H2,2-3H3,(H,27,32)(H,30,31)/b13-11+ |
| InChIKey | RCGMFBDPYJSNJR-ACCUITESSA-N |
| XLogP | 4.50 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|