C8H8N2O4S — CID 87796394
4-formyl-N-methylsulfonylpyridine-2-carboxamide (PubChem CID 87796394) has the molecular formula C8H8N2O4S and a molecular weight of 228.23 g/mol. Its IUPAC name is 4-formyl-N-methylsulfonylpyridine-2-carboxamide.
| Compound Name | 4-formyl-N-methylsulfonylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 87796394 |
| Molecular Formula | C8H8N2O4S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 4-formyl-N-methylsulfonylpyridine-2-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(C=O)ccn1 |
| InChI | InChI=1S/C8H8N2O4S/c1-15(13,14)10-8(12)7-4-6(5-11)2-3-9-7/h2-5H,1H3,(H,10,12) |
| InChIKey | RXFMZOKAIDNAGG-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|